About bis(pyridine);1,4-xylene;hydrobromide
bis(pyridine);1,4-xylene;hydrobromide (PubChem CID 70404637) has the molecular formula C18H21BrN2
and a molecular weight of 345.28 g/mol. Its IUPAC name is bis(pyridine);1,4-xylene;hydrobromide.
Molecular Properties
| Compound Name | bis(pyridine);1,4-xylene;hydrobromide |
| PubChem CID | 70404637 |
| Molecular Formula | C18H21BrN2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | bis(pyridine);1,4-xylene;hydrobromide |
| SMILES | Br.Cc1ccc(C)cc1.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/C8H10.2C5H5N.BrH/c1-7-3-5-8(2)6-4-7;2*1-2-4-6-5-3-1;/h3-6H,1-2H3;2*1-5H;1H |
| InChIKey | SSZMHHGYQOWTLG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(pyridine);1,4-xylene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(pyridine);1,4-xylene;hydrobromide?
The IUPAC name of bis(pyridine);1,4-xylene;hydrobromide (CID 70404637) is bis(pyridine);1,4-xylene;hydrobromide.
What is the SMILES notation for bis(pyridine);1,4-xylene;hydrobromide?
The canonical SMILES for bis(pyridine);1,4-xylene;hydrobromide is Br.Cc1ccc(C)cc1.c1ccncc1.c1ccncc1.
What is the InChIKey of bis(pyridine);1,4-xylene;hydrobromide?
The InChIKey is SSZMHHGYQOWTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2C5H5N.BrH/c1-7-3-5-8(2)6-4-7;2*1-2-4-6-5-3-1;/h3-6H,1-2H3;2*1-5H;1H.
What are the key properties of bis(pyridine);1,4-xylene;hydrobromide?
bis(pyridine);1,4-xylene;hydrobromide has a molecular weight of 345.28 g/mol, XLogP of 5.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(pyridine);1,4-xylene;hydrobromide is sourced from PubChem (CID 70404637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).