About 4-methylbenzoyl chloride;pyridine
4-methylbenzoyl chloride;pyridine (PubChem CID 131721472) has the molecular formula C13H12ClNO
and a molecular weight of 233.70 g/mol. Its IUPAC name is 4-methylbenzoyl chloride;pyridine.
Molecular Properties
| Compound Name | 4-methylbenzoyl chloride;pyridine |
| PubChem CID | 131721472 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-methylbenzoyl chloride;pyridine |
| SMILES | Cc1ccc(C(=O)Cl)cc1.c1ccncc1 |
| InChI | InChI=1S/C8H7ClO.C5H5N/c1-6-2-4-7(5-3-6)8(9)10;1-2-4-6-5-3-1/h2-5H,1H3;1-5H |
| InChIKey | ZNXKDSPEPRMGCK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzoyl chloride;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzoyl chloride;pyridine?
The IUPAC name of 4-methylbenzoyl chloride;pyridine (CID 131721472) is 4-methylbenzoyl chloride;pyridine.
What is the SMILES notation for 4-methylbenzoyl chloride;pyridine?
The canonical SMILES for 4-methylbenzoyl chloride;pyridine is Cc1ccc(C(=O)Cl)cc1.c1ccncc1.
What is the InChIKey of 4-methylbenzoyl chloride;pyridine?
The InChIKey is ZNXKDSPEPRMGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO.C5H5N/c1-6-2-4-7(5-3-6)8(9)10;1-2-4-6-5-3-1/h2-5H,1H3;1-5H.
What are the key properties of 4-methylbenzoyl chloride;pyridine?
4-methylbenzoyl chloride;pyridine has a molecular weight of 233.70 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzoyl chloride;pyridine is sourced from PubChem (CID 131721472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).