About benzoyl chloride;dimethyltin
benzoyl chloride;dimethyltin (PubChem CID 174591343) has the molecular formula C9H11ClOSn
and a molecular weight of 289.35 g/mol. Its IUPAC name is benzoyl chloride;dimethyltin.
Molecular Properties
| Compound Name | benzoyl chloride;dimethyltin |
| PubChem CID | 174591343 |
| Molecular Formula | C9H11ClOSn |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | benzoyl chloride;dimethyltin |
| SMILES | C[Sn]C.O=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C7H5ClO.2CH3.Sn/c8-7(9)6-4-2-1-3-5-6;;;/h1-5H;2*1H3; |
| InChIKey | YMMYYNIYRMWLJY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze benzoyl chloride;dimethyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl chloride;dimethyltin?
The IUPAC name of benzoyl chloride;dimethyltin (CID 174591343) is benzoyl chloride;dimethyltin.
What is the SMILES notation for benzoyl chloride;dimethyltin?
The canonical SMILES for benzoyl chloride;dimethyltin is C[Sn]C.O=C(Cl)c1ccccc1.
What is the InChIKey of benzoyl chloride;dimethyltin?
The InChIKey is YMMYYNIYRMWLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO.2CH3.Sn/c8-7(9)6-4-2-1-3-5-6;;;/h1-5H;2*1H3;.
What are the key properties of benzoyl chloride;dimethyltin?
benzoyl chloride;dimethyltin has a molecular weight of 289.35 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl chloride;dimethyltin is sourced from PubChem (CID 174591343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).