About benzoyl chloride;selane
benzoyl chloride;selane (PubChem CID 174449470) has the molecular formula C7H7ClOSe
and a molecular weight of 221.55 g/mol. Its IUPAC name is benzoyl chloride;selane.
Molecular Properties
| Compound Name | benzoyl chloride;selane |
| PubChem CID | 174449470 |
| Molecular Formula | C7H7ClOSe |
| Molecular Weight | 221.55 g/mol |
| Exact Mass | 221.94 |
| IUPAC Name | benzoyl chloride;selane |
| SMILES | O=C(Cl)c1ccccc1.[SeH2] |
| InChI | InChI=1S/C7H5ClO.H2Se/c8-7(9)6-4-2-1-3-5-6;/h1-5H;1H2 |
| InChIKey | OGKVUKASMLMXPZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.55 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzoyl chloride;selane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl chloride;selane?
The IUPAC name of benzoyl chloride;selane (CID 174449470) is benzoyl chloride;selane.
What is the SMILES notation for benzoyl chloride;selane?
The canonical SMILES for benzoyl chloride;selane is O=C(Cl)c1ccccc1.[SeH2].
What is the InChIKey of benzoyl chloride;selane?
The InChIKey is OGKVUKASMLMXPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO.H2Se/c8-7(9)6-4-2-1-3-5-6;/h1-5H;1H2.
What are the key properties of benzoyl chloride;selane?
benzoyl chloride;selane has a molecular weight of 221.55 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl chloride;selane is sourced from PubChem (CID 174449470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).