About tetrakis(carbonochloridic acid);diphenylmethanone
tetrakis(carbonochloridic acid);diphenylmethanone (PubChem CID 173240243) has the molecular formula C17H14Cl4O9
and a molecular weight of 504.10 g/mol. Its IUPAC name is tetrakis(carbonochloridic acid);diphenylmethanone.
Molecular Properties
| Compound Name | tetrakis(carbonochloridic acid);diphenylmethanone |
| PubChem CID | 173240243 |
| Molecular Formula | C17H14Cl4O9 |
| Molecular Weight | 504.10 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | tetrakis(carbonochloridic acid);diphenylmethanone |
| SMILES | O=C(O)Cl.O=C(O)Cl.O=C(O)Cl.O=C(O)Cl.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.4CHClO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;4*2-1(3)4/h1-10H;4*(H,3,4) |
| InChIKey | WEJBKNJUEXQKCR-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.10 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(carbonochloridic acid);diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(carbonochloridic acid);diphenylmethanone?
The IUPAC name of tetrakis(carbonochloridic acid);diphenylmethanone (CID 173240243) is tetrakis(carbonochloridic acid);diphenylmethanone.
What is the SMILES notation for tetrakis(carbonochloridic acid);diphenylmethanone?
The canonical SMILES for tetrakis(carbonochloridic acid);diphenylmethanone is O=C(O)Cl.O=C(O)Cl.O=C(O)Cl.O=C(O)Cl.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of tetrakis(carbonochloridic acid);diphenylmethanone?
The InChIKey is WEJBKNJUEXQKCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.4CHClO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;4*2-1(3)4/h1-10H;4*(H,3,4).
What are the key properties of tetrakis(carbonochloridic acid);diphenylmethanone?
tetrakis(carbonochloridic acid);diphenylmethanone has a molecular weight of 504.10 g/mol, XLogP of 6.53, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(carbonochloridic acid);diphenylmethanone is sourced from PubChem (CID 173240243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).