About chloroethene;diphenylmethanone
chloroethene;diphenylmethanone (PubChem CID 159955636) has the molecular formula C15H13ClO
and a molecular weight of 244.72 g/mol. Its IUPAC name is chloroethene;diphenylmethanone.
Molecular Properties
| Compound Name | chloroethene;diphenylmethanone |
| PubChem CID | 159955636 |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | chloroethene;diphenylmethanone |
| SMILES | C=CCl.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C2H3Cl/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-3/h1-10H;2H,1H2 |
| InChIKey | OCRFHEIBXXINRY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chloroethene;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroethene;diphenylmethanone?
The IUPAC name of chloroethene;diphenylmethanone (CID 159955636) is chloroethene;diphenylmethanone.
What is the SMILES notation for chloroethene;diphenylmethanone?
The canonical SMILES for chloroethene;diphenylmethanone is C=CCl.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of chloroethene;diphenylmethanone?
The InChIKey is OCRFHEIBXXINRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C2H3Cl/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-3/h1-10H;2H,1H2.
What are the key properties of chloroethene;diphenylmethanone?
chloroethene;diphenylmethanone has a molecular weight of 244.72 g/mol, XLogP of 4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroethene;diphenylmethanone is sourced from PubChem (CID 159955636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).