About diphenylmethanone;1-phenylbut-3-en-1-one
diphenylmethanone;1-phenylbut-3-en-1-one (PubChem CID 122640182) has the molecular formula C23H20O2
and a molecular weight of 328.41 g/mol. Its IUPAC name is diphenylmethanone;1-phenylbut-3-en-1-one.
Molecular Properties
| Compound Name | diphenylmethanone;1-phenylbut-3-en-1-one |
| PubChem CID | 122640182 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | diphenylmethanone;1-phenylbut-3-en-1-one |
| SMILES | C=CCC(=O)c1ccccc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C10H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-6-10(11)9-7-4-3-5-8-9/h1-10H;2-5,7-8H,1,6H2 |
| InChIKey | BPMINJXPQLTXOJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;1-phenylbut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;1-phenylbut-3-en-1-one?
The IUPAC name of diphenylmethanone;1-phenylbut-3-en-1-one (CID 122640182) is diphenylmethanone;1-phenylbut-3-en-1-one.
What is the SMILES notation for diphenylmethanone;1-phenylbut-3-en-1-one?
The canonical SMILES for diphenylmethanone;1-phenylbut-3-en-1-one is C=CCC(=O)c1ccccc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;1-phenylbut-3-en-1-one?
The InChIKey is BPMINJXPQLTXOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C10H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-6-10(11)9-7-4-3-5-8-9/h1-10H;2-5,7-8H,1,6H2.
What are the key properties of diphenylmethanone;1-phenylbut-3-en-1-one?
diphenylmethanone;1-phenylbut-3-en-1-one has a molecular weight of 328.41 g/mol, XLogP of 5.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;1-phenylbut-3-en-1-one is sourced from PubChem (CID 122640182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).