About disodium;diphenylmethanone
disodium;diphenylmethanone (PubChem CID 19380838) has the molecular formula C13H10Na2O+2
and a molecular weight of 228.20 g/mol. Its IUPAC name is disodium;diphenylmethanone.
Molecular Properties
| Compound Name | disodium;diphenylmethanone |
| PubChem CID | 19380838 |
| Molecular Formula | C13H10Na2O+2 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | disodium;diphenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C13H10O.2Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10H;;/q;2*+1 |
| InChIKey | OKKOKSCNDJITPK-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze disodium;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;diphenylmethanone?
The IUPAC name of disodium;diphenylmethanone (CID 19380838) is disodium;diphenylmethanone.
What is the SMILES notation for disodium;diphenylmethanone?
The canonical SMILES for disodium;diphenylmethanone is O=C(c1ccccc1)c1ccccc1.[Na+].[Na+].
What is the InChIKey of disodium;diphenylmethanone?
The InChIKey is OKKOKSCNDJITPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.2Na/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10H;;/q;2*+1.
What are the key properties of disodium;diphenylmethanone?
disodium;diphenylmethanone has a molecular weight of 228.20 g/mol, XLogP of -3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;diphenylmethanone is sourced from PubChem (CID 19380838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).