About diphenylmethanone;gold
diphenylmethanone;gold (PubChem CID 174931146) has the molecular formula C13H10AuO
and a molecular weight of 379.19 g/mol. Its IUPAC name is diphenylmethanone;gold.
Molecular Properties
| Compound Name | diphenylmethanone;gold |
| PubChem CID | 174931146 |
| Molecular Formula | C13H10AuO |
| Molecular Weight | 379.19 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | diphenylmethanone;gold |
| SMILES | O=C(c1ccccc1)c1ccccc1.[Au] |
| InChI | InChI=1S/C13H10O.Au/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H; |
| InChIKey | FEKNYEJVNKICCQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanone;gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;gold?
The IUPAC name of diphenylmethanone;gold (CID 174931146) is diphenylmethanone;gold.
What is the SMILES notation for diphenylmethanone;gold?
The canonical SMILES for diphenylmethanone;gold is O=C(c1ccccc1)c1ccccc1.[Au].
What is the InChIKey of diphenylmethanone;gold?
The InChIKey is FEKNYEJVNKICCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.Au/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H;.
What are the key properties of diphenylmethanone;gold?
diphenylmethanone;gold has a molecular weight of 379.19 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;gold is sourced from PubChem (CID 174931146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).