About diphenylmethanone;hydron;fluoride
diphenylmethanone;hydron;fluoride (PubChem CID 21465824) has the molecular formula C13H11FO
and a molecular weight of 202.23 g/mol. Its IUPAC name is diphenylmethanone;hydron;fluoride.
Molecular Properties
| Compound Name | diphenylmethanone;hydron;fluoride |
| PubChem CID | 21465824 |
| Molecular Formula | C13H11FO |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | diphenylmethanone;hydron;fluoride |
| SMILES | O=C(c1ccccc1)c1ccccc1.[F-].[H+] |
| InChI | InChI=1S/C13H10O.FH/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H;1H |
| InChIKey | OWWVAVMUYQFBOC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanone;hydron;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;hydron;fluoride?
The IUPAC name of diphenylmethanone;hydron;fluoride (CID 21465824) is diphenylmethanone;hydron;fluoride.
What is the SMILES notation for diphenylmethanone;hydron;fluoride?
The canonical SMILES for diphenylmethanone;hydron;fluoride is O=C(c1ccccc1)c1ccccc1.[F-].[H+].
What is the InChIKey of diphenylmethanone;hydron;fluoride?
The InChIKey is OWWVAVMUYQFBOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.FH/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H;1H.
What are the key properties of diphenylmethanone;hydron;fluoride?
diphenylmethanone;hydron;fluoride has a molecular weight of 202.23 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;hydron;fluoride is sourced from PubChem (CID 21465824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).