About 2,2-dimethylpropane;diphenylmethanone
2,2-dimethylpropane;diphenylmethanone (PubChem CID 159191976) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2,2-dimethylpropane;diphenylmethanone.
Molecular Properties
| Compound Name | 2,2-dimethylpropane;diphenylmethanone |
| PubChem CID | 159191976 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2,2-dimethylpropane;diphenylmethanone |
| SMILES | CC(C)(C)C.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C5H12/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5(2,3)4/h1-10H;1-4H3 |
| InChIKey | KOEUELYJHXRFEJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethylpropane;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;diphenylmethanone?
The IUPAC name of 2,2-dimethylpropane;diphenylmethanone (CID 159191976) is 2,2-dimethylpropane;diphenylmethanone.
What is the SMILES notation for 2,2-dimethylpropane;diphenylmethanone?
The canonical SMILES for 2,2-dimethylpropane;diphenylmethanone is CC(C)(C)C.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2,2-dimethylpropane;diphenylmethanone?
The InChIKey is KOEUELYJHXRFEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C5H12/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5(2,3)4/h1-10H;1-4H3.
What are the key properties of 2,2-dimethylpropane;diphenylmethanone?
2,2-dimethylpropane;diphenylmethanone has a molecular weight of 254.37 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;diphenylmethanone is sourced from PubChem (CID 159191976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).