About diphenylmethanone;isocyanic acid
diphenylmethanone;isocyanic acid (PubChem CID 87839825) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is diphenylmethanone;isocyanic acid.
Molecular Properties
| Compound Name | diphenylmethanone;isocyanic acid |
| PubChem CID | 87839825 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | diphenylmethanone;isocyanic acid |
| SMILES | N=C=O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.CHNO/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1-3/h1-10H;2H |
| InChIKey | RUOQXHSXNGCSPC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;isocyanic acid?
The IUPAC name of diphenylmethanone;isocyanic acid (CID 87839825) is diphenylmethanone;isocyanic acid.
What is the SMILES notation for diphenylmethanone;isocyanic acid?
The canonical SMILES for diphenylmethanone;isocyanic acid is N=C=O.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;isocyanic acid?
The InChIKey is RUOQXHSXNGCSPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.CHNO/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1-3/h1-10H;2H.
What are the key properties of diphenylmethanone;isocyanic acid?
diphenylmethanone;isocyanic acid has a molecular weight of 225.25 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;isocyanic acid is sourced from PubChem (CID 87839825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).