About acetic acid;diphenylmethanone;hydrate
acetic acid;diphenylmethanone;hydrate (PubChem CID 161284686) has the molecular formula C15H16O4
and a molecular weight of 260.29 g/mol. Its IUPAC name is acetic acid;diphenylmethanone;hydrate.
Molecular Properties
| Compound Name | acetic acid;diphenylmethanone;hydrate |
| PubChem CID | 161284686 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | acetic acid;diphenylmethanone;hydrate |
| SMILES | CC(=O)O.O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C2H4O2.H2O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2(3)4;/h1-10H;1H3,(H,3,4);1H2 |
| InChIKey | NFTXXCMLSBBGCF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;diphenylmethanone;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;diphenylmethanone;hydrate?
The IUPAC name of acetic acid;diphenylmethanone;hydrate (CID 161284686) is acetic acid;diphenylmethanone;hydrate.
What is the SMILES notation for acetic acid;diphenylmethanone;hydrate?
The canonical SMILES for acetic acid;diphenylmethanone;hydrate is CC(=O)O.O.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of acetic acid;diphenylmethanone;hydrate?
The InChIKey is NFTXXCMLSBBGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C2H4O2.H2O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2(3)4;/h1-10H;1H3,(H,3,4);1H2.
What are the key properties of acetic acid;diphenylmethanone;hydrate?
acetic acid;diphenylmethanone;hydrate has a molecular weight of 260.29 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;diphenylmethanone;hydrate is sourced from PubChem (CID 161284686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).