About bis(diphenylmethanone);2-methylprop-2-enoic acid
bis(diphenylmethanone);2-methylprop-2-enoic acid (PubChem CID 175044660) has the molecular formula C30H26O4
and a molecular weight of 450.53 g/mol. Its IUPAC name is bis(diphenylmethanone);2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | bis(diphenylmethanone);2-methylprop-2-enoic acid |
| PubChem CID | 175044660 |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | bis(diphenylmethanone);2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.O=C(c1ccccc1)c1ccccc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C13H10O.C4H6O2/c2*14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3(2)4(5)6/h2*1-10H;1H2,2H3,(H,5,6) |
| InChIKey | AQSGBNKGEQRAHN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(diphenylmethanone);2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(diphenylmethanone);2-methylprop-2-enoic acid?
The IUPAC name of bis(diphenylmethanone);2-methylprop-2-enoic acid (CID 175044660) is bis(diphenylmethanone);2-methylprop-2-enoic acid.
What is the SMILES notation for bis(diphenylmethanone);2-methylprop-2-enoic acid?
The canonical SMILES for bis(diphenylmethanone);2-methylprop-2-enoic acid is C=C(C)C(=O)O.O=C(c1ccccc1)c1ccccc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of bis(diphenylmethanone);2-methylprop-2-enoic acid?
The InChIKey is AQSGBNKGEQRAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H10O.C4H6O2/c2*14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3(2)4(5)6/h2*1-10H;1H2,2H3,(H,5,6).
What are the key properties of bis(diphenylmethanone);2-methylprop-2-enoic acid?
bis(diphenylmethanone);2-methylprop-2-enoic acid has a molecular weight of 450.53 g/mol, XLogP of 6.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(diphenylmethanone);2-methylprop-2-enoic acid is sourced from PubChem (CID 175044660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).