About cobalt(2+);diphenylmethanone
cobalt(2+);diphenylmethanone (PubChem CID 19033779) has the molecular formula C13H10CoO+2
and a molecular weight of 241.16 g/mol. Its IUPAC name is cobalt(2+);diphenylmethanone.
Molecular Properties
| Compound Name | cobalt(2+);diphenylmethanone |
| PubChem CID | 19033779 |
| Molecular Formula | C13H10CoO+2 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | cobalt(2+);diphenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1.[Co+2] |
| InChI | InChI=1S/C13H10O.Co/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H;/q;+2 |
| InChIKey | LOSHNTISMSAQIZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cobalt(2+);diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);diphenylmethanone?
The IUPAC name of cobalt(2+);diphenylmethanone (CID 19033779) is cobalt(2+);diphenylmethanone.
What is the SMILES notation for cobalt(2+);diphenylmethanone?
The canonical SMILES for cobalt(2+);diphenylmethanone is O=C(c1ccccc1)c1ccccc1.[Co+2].
What is the InChIKey of cobalt(2+);diphenylmethanone?
The InChIKey is LOSHNTISMSAQIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.Co/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H;/q;+2.
What are the key properties of cobalt(2+);diphenylmethanone?
cobalt(2+);diphenylmethanone has a molecular weight of 241.16 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);diphenylmethanone is sourced from PubChem (CID 19033779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).