About butane-2,3-diol;diphenylmethanone
butane-2,3-diol;diphenylmethanone (PubChem CID 175235923) has the molecular formula C17H20O3
and a molecular weight of 272.34 g/mol. Its IUPAC name is butane-2,3-diol;diphenylmethanone.
Molecular Properties
| Compound Name | butane-2,3-diol;diphenylmethanone |
| PubChem CID | 175235923 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | butane-2,3-diol;diphenylmethanone |
| SMILES | CC(O)C(C)O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C4H10O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3(5)4(2)6/h1-10H;3-6H,1-2H3 |
| InChIKey | OGSRHUALSRAJDX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane-2,3-diol;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-diol;diphenylmethanone?
The IUPAC name of butane-2,3-diol;diphenylmethanone (CID 175235923) is butane-2,3-diol;diphenylmethanone.
What is the SMILES notation for butane-2,3-diol;diphenylmethanone?
The canonical SMILES for butane-2,3-diol;diphenylmethanone is CC(O)C(C)O.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of butane-2,3-diol;diphenylmethanone?
The InChIKey is OGSRHUALSRAJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C4H10O2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3(5)4(2)6/h1-10H;3-6H,1-2H3.
What are the key properties of butane-2,3-diol;diphenylmethanone?
butane-2,3-diol;diphenylmethanone has a molecular weight of 272.34 g/mol, XLogP of 2.67, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-diol;diphenylmethanone is sourced from PubChem (CID 175235923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).