About sodium;hydride;3-oxo-3-phenylpropanal
sodium;hydride;3-oxo-3-phenylpropanal (PubChem CID 173206962) has the molecular formula C9H9NaO2
and a molecular weight of 172.16 g/mol. Its IUPAC name is sodium;hydride;3-oxo-3-phenylpropanal.
Molecular Properties
| Compound Name | sodium;hydride;3-oxo-3-phenylpropanal |
| PubChem CID | 173206962 |
| Molecular Formula | C9H9NaO2 |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | sodium;hydride;3-oxo-3-phenylpropanal |
| SMILES | O=CCC(=O)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C9H8O2.Na.H/c10-7-6-9(11)8-4-2-1-3-5-8;;/h1-5,7H,6H2;;/q;+1;-1 |
| InChIKey | VMABIVGRCGMKEH-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-oxo-3-phenylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-oxo-3-phenylpropanal?
The IUPAC name of sodium;hydride;3-oxo-3-phenylpropanal (CID 173206962) is sodium;hydride;3-oxo-3-phenylpropanal.
What is the SMILES notation for sodium;hydride;3-oxo-3-phenylpropanal?
The canonical SMILES for sodium;hydride;3-oxo-3-phenylpropanal is O=CCC(=O)c1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-oxo-3-phenylpropanal?
The InChIKey is VMABIVGRCGMKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.Na.H/c10-7-6-9(11)8-4-2-1-3-5-8;;/h1-5,7H,6H2;;/q;+1;-1.
What are the key properties of sodium;hydride;3-oxo-3-phenylpropanal?
sodium;hydride;3-oxo-3-phenylpropanal has a molecular weight of 172.16 g/mol, XLogP of -1.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-oxo-3-phenylpropanal is sourced from PubChem (CID 173206962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).