C12H12O — CID 14250330
1-phenylhexa-3,4-dien-1-one (PubChem CID 14250330) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-phenylhexa-3,4-dien-1-one.
| Compound Name | 1-phenylhexa-3,4-dien-1-one |
|---|---|
| PubChem CID | 14250330 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 1-phenylhexa-3,4-dien-1-one |
| SMILES | CC=C=CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h2,4-9H,10H2,1H3 |
| InChIKey | YFNGTFFKNAHWTG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |