About N-phenacylacetonitrilium
N-phenacylacetonitrilium (PubChem CID 134891497) has the molecular formula C10H10NO+
and a molecular weight of 160.20 g/mol. Its IUPAC name is N-phenacylacetonitrilium.
Molecular Properties
| Compound Name | N-phenacylacetonitrilium |
| PubChem CID | 134891497 |
| Molecular Formula | C10H10NO+ |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | N-phenacylacetonitrilium |
| SMILES | CC#[N+]CC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10NO/c1-2-11-8-10(12)9-6-4-3-5-7-9/h3-7H,8H2,1H3/q+1 |
| InChIKey | ZSSHZCZUMQDGDP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenacylacetonitrilium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenacylacetonitrilium?
The IUPAC name of N-phenacylacetonitrilium (CID 134891497) is N-phenacylacetonitrilium.
What is the SMILES notation for N-phenacylacetonitrilium?
The canonical SMILES for N-phenacylacetonitrilium is CC#[N+]CC(=O)c1ccccc1.
What is the InChIKey of N-phenacylacetonitrilium?
The InChIKey is ZSSHZCZUMQDGDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10NO/c1-2-11-8-10(12)9-6-4-3-5-7-9/h3-7H,8H2,1H3/q+1.
What are the key properties of N-phenacylacetonitrilium?
N-phenacylacetonitrilium has a molecular weight of 160.20 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenacylacetonitrilium is sourced from PubChem (CID 134891497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).