About CID 88763605
CID 88763605 (PubChem CID 88763605) has the molecular formula C9H7NOTl
and a molecular weight of 349.54 g/mol.
Molecular Properties
| Compound Name | CID 88763605 |
| PubChem CID | 88763605 |
| Molecular Formula | C9H7NOTl |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | — |
| SMILES | N#CCC(=O)c1ccccc1.[Tl] |
| InChI | InChI=1S/C9H7NO.Tl/c10-7-6-9(11)8-4-2-1-3-5-8;/h1-5H,6H2; |
| InChIKey | WOJXUMYQEGXPDT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 88763605 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88763605?
The IUPAC name of CID 88763605 (CID 88763605) is not available.
What is the SMILES notation for CID 88763605?
The canonical SMILES for CID 88763605 is N#CCC(=O)c1ccccc1.[Tl].
What is the InChIKey of CID 88763605?
The InChIKey is WOJXUMYQEGXPDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.Tl/c10-7-6-9(11)8-4-2-1-3-5-8;/h1-5H,6H2;.
What are the key properties of CID 88763605?
CID 88763605 has a molecular weight of 349.54 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88763605 is sourced from PubChem (CID 88763605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).