About methane;1-phenylpropan-1-one
methane;1-phenylpropan-1-one (PubChem CID 67638055) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is methane;1-phenylpropan-1-one.
Molecular Properties
| Compound Name | methane;1-phenylpropan-1-one |
| PubChem CID | 67638055 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | methane;1-phenylpropan-1-one |
| SMILES | C.CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H10O.CH4/c1-2-9(10)8-6-4-3-5-7-8;/h3-7H,2H2,1H3;1H4 |
| InChIKey | NXJOZAWUMIJOLY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-phenylpropan-1-one?
The IUPAC name of methane;1-phenylpropan-1-one (CID 67638055) is methane;1-phenylpropan-1-one.
What is the SMILES notation for methane;1-phenylpropan-1-one?
The canonical SMILES for methane;1-phenylpropan-1-one is C.CCC(=O)c1ccccc1.
What is the InChIKey of methane;1-phenylpropan-1-one?
The InChIKey is NXJOZAWUMIJOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.CH4/c1-2-9(10)8-6-4-3-5-7-8;/h3-7H,2H2,1H3;1H4.
What are the key properties of methane;1-phenylpropan-1-one?
methane;1-phenylpropan-1-one has a molecular weight of 150.22 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-phenylpropan-1-one is sourced from PubChem (CID 67638055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).