C12H19NO — CID 174454319
N,N-dimethylmethanamine;1-phenylpropan-1-one (PubChem CID 174454319) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1-phenylpropan-1-one.
| Compound Name | N,N-dimethylmethanamine;1-phenylpropan-1-one |
|---|---|
| PubChem CID | 174454319 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N,N-dimethylmethanamine;1-phenylpropan-1-one |
| SMILES | CCC(=O)c1ccccc1.CN(C)C |
| InChI | InChI=1S/C9H10O.C3H9N/c1-2-9(10)8-6-4-3-5-7-8;1-4(2)3/h3-7H,2H2,1H3;1-3H3 |
| InChIKey | GHWPFLTYTGFLRF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |