About anisole;1-phenylpropan-1-one;propan-2-one
anisole;1-phenylpropan-1-one;propan-2-one (PubChem CID 174786879) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is anisole;1-phenylpropan-1-one;propan-2-one.
Molecular Properties
| Compound Name | anisole;1-phenylpropan-1-one;propan-2-one |
| PubChem CID | 174786879 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | anisole;1-phenylpropan-1-one;propan-2-one |
| SMILES | CC(C)=O.CCC(=O)c1ccccc1.COc1ccccc1 |
| InChI | InChI=1S/C9H10O.C7H8O.C3H6O/c1-2-9(10)8-6-4-3-5-7-8;1-8-7-5-3-2-4-6-7;1-3(2)4/h3-7H,2H2,1H3;2-6H,1H3;1-2H3 |
| InChIKey | YOBIUJOUJIRQCR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze anisole;1-phenylpropan-1-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;1-phenylpropan-1-one;propan-2-one?
The IUPAC name of anisole;1-phenylpropan-1-one;propan-2-one (CID 174786879) is anisole;1-phenylpropan-1-one;propan-2-one.
What is the SMILES notation for anisole;1-phenylpropan-1-one;propan-2-one?
The canonical SMILES for anisole;1-phenylpropan-1-one;propan-2-one is CC(C)=O.CCC(=O)c1ccccc1.COc1ccccc1.
What is the InChIKey of anisole;1-phenylpropan-1-one;propan-2-one?
The InChIKey is YOBIUJOUJIRQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C7H8O.C3H6O/c1-2-9(10)8-6-4-3-5-7-8;1-8-7-5-3-2-4-6-7;1-3(2)4/h3-7H,2H2,1H3;2-6H,1H3;1-2H3.
What are the key properties of anisole;1-phenylpropan-1-one;propan-2-one?
anisole;1-phenylpropan-1-one;propan-2-one has a molecular weight of 300.40 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;1-phenylpropan-1-one;propan-2-one is sourced from PubChem (CID 174786879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).