About anisole;1-phenylethanone;toluene
anisole;1-phenylethanone;toluene (PubChem CID 157308620) has the molecular formula C22H24O2
and a molecular weight of 320.43 g/mol. Its IUPAC name is anisole;1-phenylethanone;toluene.
Molecular Properties
| Compound Name | anisole;1-phenylethanone;toluene |
| PubChem CID | 157308620 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | anisole;1-phenylethanone;toluene |
| SMILES | CC(=O)c1ccccc1.COc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C8H8O.C7H8O.C7H8/c1-7(9)8-5-3-2-4-6-8;1-8-7-5-3-2-4-6-7;1-7-5-3-2-4-6-7/h2-6H,1H3;2-6H,1H3;2-6H,1H3 |
| InChIKey | BCTWHTUZHQXPBU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze anisole;1-phenylethanone;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;1-phenylethanone;toluene?
The IUPAC name of anisole;1-phenylethanone;toluene (CID 157308620) is anisole;1-phenylethanone;toluene.
What is the SMILES notation for anisole;1-phenylethanone;toluene?
The canonical SMILES for anisole;1-phenylethanone;toluene is CC(=O)c1ccccc1.COc1ccccc1.Cc1ccccc1.
What is the InChIKey of anisole;1-phenylethanone;toluene?
The InChIKey is BCTWHTUZHQXPBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C7H8O.C7H8/c1-7(9)8-5-3-2-4-6-8;1-8-7-5-3-2-4-6-7;1-7-5-3-2-4-6-7/h2-6H,1H3;2-6H,1H3;2-6H,1H3.
What are the key properties of anisole;1-phenylethanone;toluene?
anisole;1-phenylethanone;toluene has a molecular weight of 320.43 g/mol, XLogP of 5.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;1-phenylethanone;toluene is sourced from PubChem (CID 157308620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).