About carbon monoxide;1-phenylethanone;toluene
carbon monoxide;1-phenylethanone;toluene (PubChem CID 158914784) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is carbon monoxide;1-phenylethanone;toluene.
Molecular Properties
| Compound Name | carbon monoxide;1-phenylethanone;toluene |
| PubChem CID | 158914784 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | carbon monoxide;1-phenylethanone;toluene |
| SMILES | CC(=O)c1ccccc1.Cc1ccccc1.[C-]#[O+] |
| InChI | InChI=1S/C8H8O.C7H8.CO/c1-7(9)8-5-3-2-4-6-8;1-7-5-3-2-4-6-7;1-2/h2-6H,1H3;2-6H,1H3; |
| InChIKey | JHCFLGYMULRLGE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 36.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;1-phenylethanone;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;1-phenylethanone;toluene?
The IUPAC name of carbon monoxide;1-phenylethanone;toluene (CID 158914784) is carbon monoxide;1-phenylethanone;toluene.
What is the SMILES notation for carbon monoxide;1-phenylethanone;toluene?
The canonical SMILES for carbon monoxide;1-phenylethanone;toluene is CC(=O)c1ccccc1.Cc1ccccc1.[C-]#[O+].
What is the InChIKey of carbon monoxide;1-phenylethanone;toluene?
The InChIKey is JHCFLGYMULRLGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C7H8.CO/c1-7(9)8-5-3-2-4-6-8;1-7-5-3-2-4-6-7;1-2/h2-6H,1H3;2-6H,1H3;.
What are the key properties of carbon monoxide;1-phenylethanone;toluene?
carbon monoxide;1-phenylethanone;toluene has a molecular weight of 240.30 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;1-phenylethanone;toluene is sourced from PubChem (CID 158914784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).