C17H22N2O — CID 161301580
1-(4-aminophenyl)propan-1-one;N,N-dimethylaniline (PubChem CID 161301580) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-(4-aminophenyl)propan-1-one;N,N-dimethylaniline.
| Compound Name | 1-(4-aminophenyl)propan-1-one;N,N-dimethylaniline |
|---|---|
| PubChem CID | 161301580 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-(4-aminophenyl)propan-1-one;N,N-dimethylaniline |
| SMILES | CCC(=O)c1ccc(N)cc1.CN(C)c1ccccc1 |
| InChI | InChI=1S/C9H11NO.C8H11N/c1-2-9(11)7-3-5-8(10)6-4-7;1-9(2)8-6-4-3-5-7-8/h3-6H,2,10H2,1H3;3-7H,1-2H3 |
| InChIKey | VHRPEXVSPWHTJV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|