About 2-(N-methylanilino)ethyl 4-propanoylbenzoate
2-(N-methylanilino)ethyl 4-propanoylbenzoate (PubChem CID 59444962) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-(N-methylanilino)ethyl 4-propanoylbenzoate.
Molecular Properties
| Compound Name | 2-(N-methylanilino)ethyl 4-propanoylbenzoate |
| PubChem CID | 59444962 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-(N-methylanilino)ethyl 4-propanoylbenzoate |
| SMILES | CCC(=O)c1ccc(C(=O)OCCN(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-3-18(21)15-9-11-16(12-10-15)19(22)23-14-13-20(2)17-7-5-4-6-8-17/h4-12H,3,13-14H2,1-2H3 |
| InChIKey | GBDFDLXNFTZQMC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(N-methylanilino)ethyl 4-propanoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-methylanilino)ethyl 4-propanoylbenzoate?
The IUPAC name of 2-(N-methylanilino)ethyl 4-propanoylbenzoate (CID 59444962) is 2-(N-methylanilino)ethyl 4-propanoylbenzoate.
What is the SMILES notation for 2-(N-methylanilino)ethyl 4-propanoylbenzoate?
The canonical SMILES for 2-(N-methylanilino)ethyl 4-propanoylbenzoate is CCC(=O)c1ccc(C(=O)OCCN(C)c2ccccc2)cc1.
What is the InChIKey of 2-(N-methylanilino)ethyl 4-propanoylbenzoate?
The InChIKey is GBDFDLXNFTZQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-3-18(21)15-9-11-16(12-10-15)19(22)23-14-13-20(2)17-7-5-4-6-8-17/h4-12H,3,13-14H2,1-2H3.
What are the key properties of 2-(N-methylanilino)ethyl 4-propanoylbenzoate?
2-(N-methylanilino)ethyl 4-propanoylbenzoate has a molecular weight of 311.38 g/mol, XLogP of 3.57, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-methylanilino)ethyl 4-propanoylbenzoate is sourced from PubChem (CID 59444962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).