About 2-(dimethylamino)ethyl benzoate;hydroiodide
2-(dimethylamino)ethyl benzoate;hydroiodide (PubChem CID 2752377) has the molecular formula C11H16INO2
and a molecular weight of 321.16 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl benzoate;hydroiodide.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl benzoate;hydroiodide |
| PubChem CID | 2752377 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-(dimethylamino)ethyl benzoate;hydroiodide |
| SMILES | CN(C)CCOC(=O)c1ccccc1.I |
| InChI | InChI=1S/C11H15NO2.HI/c1-12(2)8-9-14-11(13)10-6-4-3-5-7-10;/h3-7H,8-9H2,1-2H3;1H |
| InChIKey | XIKQIIOXVWPLLW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl benzoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl benzoate;hydroiodide?
The IUPAC name of 2-(dimethylamino)ethyl benzoate;hydroiodide (CID 2752377) is 2-(dimethylamino)ethyl benzoate;hydroiodide.
What is the SMILES notation for 2-(dimethylamino)ethyl benzoate;hydroiodide?
The canonical SMILES for 2-(dimethylamino)ethyl benzoate;hydroiodide is CN(C)CCOC(=O)c1ccccc1.I.
What is the InChIKey of 2-(dimethylamino)ethyl benzoate;hydroiodide?
The InChIKey is XIKQIIOXVWPLLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.HI/c1-12(2)8-9-14-11(13)10-6-4-3-5-7-10;/h3-7H,8-9H2,1-2H3;1H.
What are the key properties of 2-(dimethylamino)ethyl benzoate;hydroiodide?
2-(dimethylamino)ethyl benzoate;hydroiodide has a molecular weight of 321.16 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl benzoate;hydroiodide is sourced from PubChem (CID 2752377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).