About 2-(dimethylamino)ethyl 3-ethylbenzoate
2-(dimethylamino)ethyl 3-ethylbenzoate (PubChem CID 70999207) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3-ethylbenzoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 3-ethylbenzoate |
| PubChem CID | 70999207 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 3-ethylbenzoate |
| SMILES | CCc1cccc(C(=O)OCCN(C)C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-4-11-6-5-7-12(10-11)13(15)16-9-8-14(2)3/h5-7,10H,4,8-9H2,1-3H3 |
| InChIKey | ZORHFCHRNFEBLS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylamino)ethyl 3-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 3-ethylbenzoate?
The IUPAC name of 2-(dimethylamino)ethyl 3-ethylbenzoate (CID 70999207) is 2-(dimethylamino)ethyl 3-ethylbenzoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 3-ethylbenzoate?
The canonical SMILES for 2-(dimethylamino)ethyl 3-ethylbenzoate is CCc1cccc(C(=O)OCCN(C)C)c1.
What is the InChIKey of 2-(dimethylamino)ethyl 3-ethylbenzoate?
The InChIKey is ZORHFCHRNFEBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-4-11-6-5-7-12(10-11)13(15)16-9-8-14(2)3/h5-7,10H,4,8-9H2,1-3H3.
What are the key properties of 2-(dimethylamino)ethyl 3-ethylbenzoate?
2-(dimethylamino)ethyl 3-ethylbenzoate has a molecular weight of 221.30 g/mol, XLogP of 1.97, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 3-ethylbenzoate is sourced from PubChem (CID 70999207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).