C18H28N2O4 — CID 139953071
bis[3-(dimethylamino)propyl] benzene-1,3-dicarboxylate (PubChem CID 139953071) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is bis[3-(dimethylamino)propyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[3-(dimethylamino)propyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 139953071 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | bis[3-(dimethylamino)propyl] benzene-1,3-dicarboxylate |
| SMILES | CN(C)CCCOC(=O)c1cccc(C(=O)OCCCN(C)C)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-19(2)10-6-12-23-17(21)15-8-5-9-16(14-15)18(22)24-13-7-11-20(3)4/h5,8-9,14H,6-7,10-13H2,1-4H3 |
| InChIKey | GWOBJAWSNWZVAU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|