About 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride
3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride (PubChem CID 2913040) has the molecular formula C13H20ClNO3
and a molecular weight of 273.76 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride |
| PubChem CID | 2913040 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride |
| SMILES | COc1cccc(C(=O)OCCCN(C)C)c1.Cl |
| InChI | InChI=1S/C13H19NO3.ClH/c1-14(2)8-5-9-17-13(15)11-6-4-7-12(10-11)16-3;/h4,6-7,10H,5,8-9H2,1-3H3;1H |
| InChIKey | CBKUJARDQJLEFT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride?
The IUPAC name of 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride (CID 2913040) is 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride.
What is the SMILES notation for 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride?
The canonical SMILES for 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride is COc1cccc(C(=O)OCCCN(C)C)c1.Cl.
What is the InChIKey of 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride?
The InChIKey is CBKUJARDQJLEFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3.ClH/c1-14(2)8-5-9-17-13(15)11-6-4-7-12(10-11)16-3;/h4,6-7,10H,5,8-9H2,1-3H3;1H.
What are the key properties of 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride?
3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride has a molecular weight of 273.76 g/mol, XLogP of 2.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 3-methoxybenzoate;hydrochloride is sourced from PubChem (CID 2913040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).