About 3-(dimethylamino)propyl 3-aminobenzoate
3-(dimethylamino)propyl 3-aminobenzoate (PubChem CID 114526412) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 3-aminobenzoate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 3-aminobenzoate |
| PubChem CID | 114526412 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-(dimethylamino)propyl 3-aminobenzoate |
| SMILES | CN(C)CCCOC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C12H18N2O2/c1-14(2)7-4-8-16-12(15)10-5-3-6-11(13)9-10/h3,5-6,9H,4,7-8,13H2,1-2H3 |
| InChIKey | NVVDJBSIUFLKJF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 3-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 3-aminobenzoate?
The IUPAC name of 3-(dimethylamino)propyl 3-aminobenzoate (CID 114526412) is 3-(dimethylamino)propyl 3-aminobenzoate.
What is the SMILES notation for 3-(dimethylamino)propyl 3-aminobenzoate?
The canonical SMILES for 3-(dimethylamino)propyl 3-aminobenzoate is CN(C)CCCOC(=O)c1cccc(N)c1.
What is the InChIKey of 3-(dimethylamino)propyl 3-aminobenzoate?
The InChIKey is NVVDJBSIUFLKJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-14(2)7-4-8-16-12(15)10-5-3-6-11(13)9-10/h3,5-6,9H,4,7-8,13H2,1-2H3.
What are the key properties of 3-(dimethylamino)propyl 3-aminobenzoate?
3-(dimethylamino)propyl 3-aminobenzoate has a molecular weight of 222.29 g/mol, XLogP of 1.38, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 3-aminobenzoate is sourced from PubChem (CID 114526412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).