C17H30N4O — CID 11404016
3-amino-N,N-bis[3-(dimethylamino)propyl]benzamide (PubChem CID 11404016) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-amino-N,N-bis[3-(dimethylamino)propyl]benzamide.
| Compound Name | 3-amino-N,N-bis[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 11404016 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 3-amino-N,N-bis[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C17H30N4O/c1-19(2)10-6-12-21(13-7-11-20(3)4)17(22)15-8-5-9-16(18)14-15/h5,8-9,14H,6-7,10-13,18H2,1-4H3 |
| InChIKey | SEEJGUGDECAPHX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|