C27H48N2O — CID 19389018
3-amino-N,N-didecylbenzamide (PubChem CID 19389018) has the molecular formula C27H48N2O and a molecular weight of 416.69 g/mol. Its IUPAC name is 3-amino-N,N-didecylbenzamide.
| Compound Name | 3-amino-N,N-didecylbenzamide |
|---|---|
| PubChem CID | 19389018 |
| Molecular Formula | C27H48N2O |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.38 |
| IUPAC Name | 3-amino-N,N-didecylbenzamide |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C27H48N2O/c1-3-5-7-9-11-13-15-17-22-29(23-18-16-14-12-10-8-6-4-2)27(30)25-20-19-21-26(28)24-25/h19-21,24H,3-18,22-23,28H2,1-2H3 |
| InChIKey | VLTLMWUGMWHMOH-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|