About 3-methoxybutyl 3-methoxybenzoate
3-methoxybutyl 3-methoxybenzoate (PubChem CID 71869294) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is 3-methoxybutyl 3-methoxybenzoate.
Molecular Properties
| Compound Name | 3-methoxybutyl 3-methoxybenzoate |
| PubChem CID | 71869294 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-methoxybutyl 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCCC(C)OC)c1 |
| InChI | InChI=1S/C13H18O4/c1-10(15-2)7-8-17-13(14)11-5-4-6-12(9-11)16-3/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | JYPFYKHRPUWNGU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxybutyl 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybutyl 3-methoxybenzoate?
The IUPAC name of 3-methoxybutyl 3-methoxybenzoate (CID 71869294) is 3-methoxybutyl 3-methoxybenzoate.
What is the SMILES notation for 3-methoxybutyl 3-methoxybenzoate?
The canonical SMILES for 3-methoxybutyl 3-methoxybenzoate is COc1cccc(C(=O)OCCC(C)OC)c1.
What is the InChIKey of 3-methoxybutyl 3-methoxybenzoate?
The InChIKey is JYPFYKHRPUWNGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-10(15-2)7-8-17-13(14)11-5-4-6-12(9-11)16-3/h4-6,9-10H,7-8H2,1-3H3.
What are the key properties of 3-methoxybutyl 3-methoxybenzoate?
3-methoxybutyl 3-methoxybenzoate has a molecular weight of 238.28 g/mol, XLogP of 2.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutyl 3-methoxybenzoate is sourced from PubChem (CID 71869294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).