C21H24O5 — CID 91737017
3-O-(4-methoxyphenyl) 1-O-(4-methylpentyl) benzene-1,3-dicarboxylate (PubChem CID 91737017) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3-O-(4-methoxyphenyl) 1-O-(4-methylpentyl) benzene-1,3-dicarboxylate.
| Compound Name | 3-O-(4-methoxyphenyl) 1-O-(4-methylpentyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91737017 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-O-(4-methoxyphenyl) 1-O-(4-methylpentyl) benzene-1,3-dicarboxylate |
| SMILES | COc1ccc(OC(=O)c2cccc(C(=O)OCCCC(C)C)c2)cc1 |
| InChI | InChI=1S/C21H24O5/c1-15(2)6-5-13-25-20(22)16-7-4-8-17(14-16)21(23)26-19-11-9-18(24-3)10-12-19/h4,7-12,14-15H,5-6,13H2,1-3H3 |
| InChIKey | PYVSIZLMLBGAHJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|