C40H54O4 — CID 172795695
bis[4-(8-methylnonyl)phenyl] benzene-1,3-dicarboxylate (PubChem CID 172795695) has the molecular formula C40H54O4 and a molecular weight of 598.87 g/mol. Its IUPAC name is bis[4-(8-methylnonyl)phenyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[4-(8-methylnonyl)phenyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 172795695 |
| Molecular Formula | C40H54O4 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.40 |
| IUPAC Name | bis[4-(8-methylnonyl)phenyl] benzene-1,3-dicarboxylate |
| SMILES | CC(C)CCCCCCCc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(CCCCCCCC(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C40H54O4/c1-31(2)16-11-7-5-9-13-18-33-22-26-37(27-23-33)43-39(41)35-20-15-21-36(30-35)40(42)44-38-28-24-34(25-29-38)19-14-10-6-8-12-17-32(3)4/h15,20-32H,5-14,16-19H2,1-4H3 |
| InChIKey | QEBTWSBJDKRLBD-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|