About (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate
(4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate (PubChem CID 54040841) has the molecular formula C36H46O3
and a molecular weight of 526.76 g/mol. Its IUPAC name is (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate.
Molecular Properties
| Compound Name | (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate |
| PubChem CID | 54040841 |
| Molecular Formula | C36H46O3 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate |
| SMILES | CCCCCCCCc1ccc(OC(=O)c2ccc3c(c2)Cc2cc(OC(C)CCCCCC)ccc2-3)cc1 |
| InChI | InChI=1S/C36H46O3/c1-4-6-8-10-11-13-15-28-16-19-32(20-17-28)39-36(37)29-18-22-34-30(24-29)25-31-26-33(21-23-35(31)34)38-27(3)14-12-9-7-5-2/h16-24,26-27H,4-15,25H2,1-3H3 |
| InChIKey | LMFLWQQIZMQISH-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate?
The IUPAC name of (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate (CID 54040841) is (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate.
What is the SMILES notation for (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate?
The canonical SMILES for (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate is CCCCCCCCc1ccc(OC(=O)c2ccc3c(c2)Cc2cc(OC(C)CCCCCC)ccc2-3)cc1.
What is the InChIKey of (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate?
The InChIKey is LMFLWQQIZMQISH-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H46O3/c1-4-6-8-10-11-13-15-28-16-19-32(20-17-28)39-36(37)29-18-22-34-30(24-29)25-31-26-33(21-23-35(31)34)38-27(3)14-12-9-7-5-2/h16-24,26-27H,4-15,25H2,1-3H3.
What are the key properties of (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate?
(4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate has a molecular weight of 526.76 g/mol, XLogP of 10.12, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-octylphenyl) 7-octan-2-yloxy-9H-fluorene-2-carboxylate is sourced from PubChem (CID 54040841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).