C24H24O4 — CID 611612
6-O-methyl 2-O-(4-pentylphenyl) naphthalene-2,6-dicarboxylate (PubChem CID 611612) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is 6-O-methyl 2-O-(4-pentylphenyl) naphthalene-2,6-dicarboxylate.
| Compound Name | 6-O-methyl 2-O-(4-pentylphenyl) naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 611612 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 6-O-methyl 2-O-(4-pentylphenyl) naphthalene-2,6-dicarboxylate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc3cc(C(=O)OC)ccc3c2)cc1 |
| InChI | InChI=1S/C24H24O4/c1-3-4-5-6-17-7-13-22(14-8-17)28-24(26)21-12-10-18-15-20(23(25)27-2)11-9-19(18)16-21/h7-16H,3-6H2,1-2H3 |
| InChIKey | RLSLBTMZNDGCBZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|