C44H41BrO8 — CID 101117987
bis[4-(4-pentylphenoxy)carbonylphenyl] 4-bromobenzene-1,3-dicarboxylate (PubChem CID 101117987) has the molecular formula C44H41BrO8 and a molecular weight of 777.71 g/mol. Its IUPAC name is bis[4-(4-pentylphenoxy)carbonylphenyl] 4-bromobenzene-1,3-dicarboxylate.
| Compound Name | bis[4-(4-pentylphenoxy)carbonylphenyl] 4-bromobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101117987 |
| Molecular Formula | C44H41BrO8 |
| Molecular Weight | 777.71 g/mol |
| Exact Mass | 776.20 |
| IUPAC Name | bis[4-(4-pentylphenoxy)carbonylphenyl] 4-bromobenzene-1,3-dicarboxylate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(Br)c(C(=O)Oc4ccc(C(=O)Oc5ccc(CCCCC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C44H41BrO8/c1-3-5-7-9-30-11-20-35(21-12-30)50-41(46)32-15-24-37(25-16-32)52-43(48)34-19-28-40(45)39(29-34)44(49)53-38-26-17-33(18-27-38)42(47)51-36-22-13-31(14-23-36)10-8-6-4-2/h11-29H,3-10H2,1-2H3 |
| InChIKey | MWXPGWAVEXNNQK-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.71 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|