C54H61BrO10 — CID 101117995
bis[4-(4-decoxyphenoxy)carbonylphenyl] 4-bromobenzene-1,3-dicarboxylate (PubChem CID 101117995) has the molecular formula C54H61BrO10 and a molecular weight of 949.98 g/mol. Its IUPAC name is bis[4-(4-decoxyphenoxy)carbonylphenyl] 4-bromobenzene-1,3-dicarboxylate.
| Compound Name | bis[4-(4-decoxyphenoxy)carbonylphenyl] 4-bromobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101117995 |
| Molecular Formula | C54H61BrO10 |
| Molecular Weight | 949.98 g/mol |
| Exact Mass | 948.34 |
| IUPAC Name | bis[4-(4-decoxyphenoxy)carbonylphenyl] 4-bromobenzene-1,3-dicarboxylate |
| SMILES | CCCCCCCCCCOc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(Br)c(C(=O)Oc4ccc(C(=O)Oc5ccc(OCCCCCCCCCC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C54H61BrO10/c1-3-5-7-9-11-13-15-17-37-60-43-28-32-47(33-29-43)62-51(56)40-19-24-45(25-20-40)64-53(58)42-23-36-50(55)49(39-42)54(59)65-46-26-21-41(22-27-46)52(57)63-48-34-30-44(31-35-48)61-38-18-16-14-12-10-8-6-4-2/h19-36,39H,3-18,37-38H2,1-2H3 |
| InChIKey | GLGYDQARTZBPON-UHFFFAOYSA-N |
| XLogP | 14.36 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.98 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|