C32H36O4 — CID 100942590
bis(4-pentylphenyl) 2-ethenylbenzene-1,4-dicarboxylate (PubChem CID 100942590) has the molecular formula C32H36O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is bis(4-pentylphenyl) 2-ethenylbenzene-1,4-dicarboxylate.
| Compound Name | bis(4-pentylphenyl) 2-ethenylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 100942590 |
| Molecular Formula | C32H36O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | bis(4-pentylphenyl) 2-ethenylbenzene-1,4-dicarboxylate |
| SMILES | C=Cc1cc(C(=O)Oc2ccc(CCCCC)cc2)ccc1C(=O)Oc1ccc(CCCCC)cc1 |
| InChI | InChI=1S/C32H36O4/c1-4-7-9-11-24-13-18-28(19-14-24)35-31(33)27-17-22-30(26(6-3)23-27)32(34)36-29-20-15-25(16-21-29)12-10-8-5-2/h6,13-23H,3-5,7-12H2,1-2H3 |
| InChIKey | VHNPYHJOMRLPSI-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|