(4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate

C27H27BrO5 — CID 71410804

IUPAC(4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate
SMILESCCCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(Br)cc3)c(OC)c2)cc1
InChIInChI=1S/C27H27BrO5/c1-3-4-5-6-7-19-8-15-23(16-9-19)32-27(30)21-12-17-24(25(18-21)31-2)33-26(29)20-10-13-22(28)14-11-20/h8-18H,3-7H2,1-2H3
InChIKeyHYVDUEWIGXRHEK-UHFFFAOYSA-N
MW511.41 g/mol
LogP7.02
Rot. Bonds10

About (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate

(4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate (PubChem CID 71410804) has the molecular formula C27H27BrO5 and a molecular weight of 511.41 g/mol. Its IUPAC name is (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate.

Molecular Properties

Compound Name(4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate
PubChem CID71410804
Molecular FormulaC27H27BrO5
Molecular Weight511.41 g/mol
Exact Mass510.10
IUPAC Name(4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate
SMILESCCCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(Br)cc3)c(OC)c2)cc1
InChIInChI=1S/C27H27BrO5/c1-3-4-5-6-7-19-8-15-23(16-9-19)32-27(30)21-12-17-24(25(18-21)31-2)33-26(29)20-10-13-22(28)14-11-20/h8-18H,3-7H2,1-2H3
InChIKeyHYVDUEWIGXRHEK-UHFFFAOYSA-N
XLogP7.02
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds10
Heavy Atoms33
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500511.41
LogP ≤ 57.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate?
The IUPAC name of (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate (CID 71410804) is (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate.
What is the SMILES notation for (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate?
The canonical SMILES for (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate is CCCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(Br)cc3)c(OC)c2)cc1.
What is the InChIKey of (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate?
The InChIKey is HYVDUEWIGXRHEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27BrO5/c1-3-4-5-6-7-19-8-15-23(16-9-19)32-27(30)21-12-17-24(25(18-21)31-2)33-26(29)20-10-13-22(28)14-11-20/h8-18H,3-7H2,1-2H3.
What are the key properties of (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate?
(4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate has a molecular weight of 511.41 g/mol, XLogP of 7.02, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate is sourced from PubChem (CID 71410804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).