About (4-propylphenyl) 4-bromobenzoate
(4-propylphenyl) 4-bromobenzoate (PubChem CID 19184745) has the molecular formula C16H15BrO2
and a molecular weight of 319.20 g/mol. Its IUPAC name is (4-propylphenyl) 4-bromobenzoate.
Molecular Properties
| Compound Name | (4-propylphenyl) 4-bromobenzoate |
| PubChem CID | 19184745 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | (4-propylphenyl) 4-bromobenzoate |
| SMILES | CCCc1ccc(OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H15BrO2/c1-2-3-12-4-10-15(11-5-12)19-16(18)13-6-8-14(17)9-7-13/h4-11H,2-3H2,1H3 |
| InChIKey | HONSMJRJJOEDJB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-propylphenyl) 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propylphenyl) 4-bromobenzoate?
The IUPAC name of (4-propylphenyl) 4-bromobenzoate (CID 19184745) is (4-propylphenyl) 4-bromobenzoate.
What is the SMILES notation for (4-propylphenyl) 4-bromobenzoate?
The canonical SMILES for (4-propylphenyl) 4-bromobenzoate is CCCc1ccc(OC(=O)c2ccc(Br)cc2)cc1.
What is the InChIKey of (4-propylphenyl) 4-bromobenzoate?
The InChIKey is HONSMJRJJOEDJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrO2/c1-2-3-12-4-10-15(11-5-12)19-16(18)13-6-8-14(17)9-7-13/h4-11H,2-3H2,1H3.
What are the key properties of (4-propylphenyl) 4-bromobenzoate?
(4-propylphenyl) 4-bromobenzoate has a molecular weight of 319.20 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylphenyl) 4-bromobenzoate is sourced from PubChem (CID 19184745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).