C39H48O8 — CID 90268547
[4-(4-decylphenoxy)carbonylphenyl] 3-methoxy-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate (PubChem CID 90268547) has the molecular formula C39H48O8 and a molecular weight of 644.81 g/mol. Its IUPAC name is [4-(4-decylphenoxy)carbonylphenyl] 3-methoxy-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate.
| Compound Name | [4-(4-decylphenoxy)carbonylphenyl] 3-methoxy-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 90268547 |
| Molecular Formula | C39H48O8 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | [4-(4-decylphenoxy)carbonylphenyl] 3-methoxy-4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(CCCCCCCCCC)cc3)cc2)cc1OC |
| InChI | InChI=1S/C39H48O8/c1-5-6-7-8-9-10-11-12-15-30-16-21-33(22-17-30)46-38(41)31-18-23-34(24-19-31)47-39(42)32-20-25-35(36(28-32)43-4)44-26-13-14-27-45-37(40)29(2)3/h16-25,28H,2,5-15,26-27H2,1,3-4H3 |
| InChIKey | XLZNJIBYAXLEFM-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|