C40H45IO8 — CID 130306352
[3-iodo-4-[4-[6-(2-methylprop-2-enoyloxy)hexyl]benzoyl]oxyphenyl] 4-[6-(2-methylprop-2-enoyloxy)hexyl]benzoate (PubChem CID 130306352) has the molecular formula C40H45IO8 and a molecular weight of 780.70 g/mol. Its IUPAC name is [3-iodo-4-[4-[6-(2-methylprop-2-enoyloxy)hexyl]benzoyl]oxyphenyl] 4-[6-(2-methylprop-2-enoyloxy)hexyl]benzoate.
| Compound Name | [3-iodo-4-[4-[6-(2-methylprop-2-enoyloxy)hexyl]benzoyl]oxyphenyl] 4-[6-(2-methylprop-2-enoyloxy)hexyl]benzoate |
|---|---|
| PubChem CID | 130306352 |
| Molecular Formula | C40H45IO8 |
| Molecular Weight | 780.70 g/mol |
| Exact Mass | 780.22 |
| IUPAC Name | [3-iodo-4-[4-[6-(2-methylprop-2-enoyloxy)hexyl]benzoyl]oxyphenyl] 4-[6-(2-methylprop-2-enoyloxy)hexyl]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(CCCCCCOC(=O)C(=C)C)cc3)c(I)c2)cc1 |
| InChI | InChI=1S/C40H45IO8/c1-28(2)37(42)46-25-11-7-5-9-13-30-15-19-32(20-16-30)39(44)48-34-23-24-36(35(41)27-34)49-40(45)33-21-17-31(18-22-33)14-10-6-8-12-26-47-38(43)29(3)4/h15-24,27H,1,3,5-14,25-26H2,2,4H3 |
| InChIKey | XPBALACZGFOHFP-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.70 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|