C16H20O4 — CID 155394997
4-[5-(2-methylprop-2-enoyloxy)pentyl]benzoic acid (PubChem CID 155394997) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-[5-(2-methylprop-2-enoyloxy)pentyl]benzoic acid.
| Compound Name | 4-[5-(2-methylprop-2-enoyloxy)pentyl]benzoic acid |
|---|---|
| PubChem CID | 155394997 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-[5-(2-methylprop-2-enoyloxy)pentyl]benzoic acid |
| SMILES | C=C(C)C(=O)OCCCCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H20O4/c1-12(2)16(19)20-11-5-3-4-6-13-7-9-14(10-8-13)15(17)18/h7-10H,1,3-6,11H2,2H3,(H,17,18) |
| InChIKey | HKGDKGKFZAEULR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|