C18H26O4 — CID 177344511
8-(3,4-dihydroxyphenyl)octyl 2-methylprop-2-enoate (PubChem CID 177344511) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 8-(3,4-dihydroxyphenyl)octyl 2-methylprop-2-enoate.
| Compound Name | 8-(3,4-dihydroxyphenyl)octyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177344511 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 8-(3,4-dihydroxyphenyl)octyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H26O4/c1-14(2)18(21)22-12-8-6-4-3-5-7-9-15-10-11-16(19)17(20)13-15/h10-11,13,19-20H,1,3-9,12H2,2H3 |
| InChIKey | DSKXLYZOTOOKFO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|