C13H15ClO2 — CID 163407359
3-(3-chlorophenyl)propyl 2-methylprop-2-enoate (PubChem CID 163407359) has the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. Its IUPAC name is 3-(3-chlorophenyl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(3-chlorophenyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163407359 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-(3-chlorophenyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClO2/c1-10(2)13(15)16-8-4-6-11-5-3-7-12(14)9-11/h3,5,7,9H,1,4,6,8H2,2H3 |
| InChIKey | LISMOVMZCLPTFM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|