C17H23NO4 — CID 130199618
2-[3-(3-methylphenyl)propoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 130199618) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-[3-(3-methylphenyl)propoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-(3-methylphenyl)propoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130199618 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[3-(3-methylphenyl)propoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCCc1cccc(C)c1 |
| InChI | InChI=1S/C17H23NO4/c1-13(2)16(19)21-11-9-18-17(20)22-10-5-8-15-7-4-6-14(3)12-15/h4,6-7,12H,1,5,8-11H2,2-3H3,(H,18,20) |
| InChIKey | IIWPOFTVXGWHIS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|